1-(4-Phenylpiperidin-4-yl)butan-1-one hydrochloride
Product Code: 745783
Molecular Formula: C15H22ClNO
Molecular Weight: 267.79
7465-12-5
3-methyl-2-phenylbut-2-enamide
74650-17-2
Benzenamine, N-[(3,4-dimethoxyphenyl)methylene]-4-nitro-
74647-33-9
4-ETHYL-6-METHYL-PYRIMIDINE
74651-67-5
2,3-dimethoxy-5-[(methylamino)sulphonyl]-N-[(1-methyl-2-pyrrolidinyl)methyl]benzamide monohydrochloride
74648-17-2
3-[2-(2-IODOACETAMIDO)ACETAMIDO]-2,2,5,5-TETRAMETHYL-1-PYRROLIDINYLOXY
74647-99-7
[1,1'-Biphenyl]-4-acetic acid, a-methyl-, methyl ester
74651-63-1
2,3-dimethoxy-5-[(methylamino)sulphonyl]benzoic acid
158475-15-1
TYR-VAL-LYS-ARG-VAL-LYS
15847-17-3
1,3-Propanediamine,N3-(7-chloro-4-quinolinyl)-N1,N1-dimethyl-
7464-82-6
3-butyl-1,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione
15848-07-4
Methanethione, diphenyl-, S-oxide
74649-49-3
(1E)-3-benzyl-1-methyltriaz-1-ene
74647-93-1
2-{[(3-methylphenyl)amino](phenyl)methylidene}-1H-indene-1,3(2H)-dione
746-52-1
1,3-Dicyclohexyl-5-(1-methylbutyl)barbituric acid
74651-64-2
(-)-2,3-dimethoxy-5-[(methylamino)sulphonyl]-N-[(1-methyl-2-pyrrolidinyl)methyl]benzamide
7464-70-2
7-amino-1,3-dimethylpteridine-2,4(1H,3H)-dione
7464-66-6
bis(4-hydroxy-3-nitrophenyl)arsinous bromide
7465-04-5
[(1,3,9-trimethyl-2,6-dioxo-2,3,6,9-tetrahydro-1H-purin-8-yl)sulfanyl]acetic acid
7464-93-9
7,9-dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione
15847-65-1
1-(4-Phenylpiperidin-4-yl)butan-1-one hydrochloride
15847-65-1, CAS No. 15847-65-1,CasNo 15847-65-1,cas 15847-65-1
1-(4-Phenylpiperidin-4-yl)butan-1-one hydrochloride